Mol-LLaMA SFT
Collection
RCR_RP: Reagents Prediction; RCR_CP: Catalyst Prediction; RCR_SP: Solvent Prediction; HTE_RAS: Reagent Selection • 17 items • Updated
instruction stringlengths 42 468 | input stringclasses 1
value | output stringlengths 5 875 |
|---|---|---|
Could you tell which reactants might have been used to generate the following product? N#CCc1cc(Cl)cc(Cc2nc3c(F)c(F)cc(F)c3s2)c1 | N#CCc1cc(Cl)cc(CC#N)c1.Nc1c(F)c(F)cc(F)c1S | |
Identify possible reactants that could have been used to create the specified product. CCOC(=O)C(Cc1ccc(CC)c(CC)c1)(NC(C)=O)C(=O)OCC | CCc1ccc(CBr)cc1CC.CCO.CCOC(=O)C(NC(C)=O)C(=O)[O-] | |
Provide the potential reactants that may be used to produce the product N#Cc1n[nH]c2c(=O)[nH]c3cc(Cl)ccc3c(=O)c12 . | NC(=O)c1n[nH]c2c(=O)[nH]c3cc(Cl)ccc3c(=O)c12 | |
Can you list the reactants that might result in the chemical product CCCC#Cc1ccnc(F)c1 ? | C#CCCC.Fc1cc(I)ccn1 | |
What reactants could lead to the production of the following product? CC(C)CC(NC(=O)OCc1ccccc1)C(=O)OCC1(C)COC1 | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)O.Cc1ccccc1S(=O)(=O)OCC1(C)COC1 | |
To synthesis CSc1ccc(C(=CC2CCOCC2)c2[nH]c(-c3ccccn3)nc2Cl)cc1Cl, what are the possible reactants? Write in the SMILES representation. | CSc1ccc(C(O)(CC2CCOCC2)c2c(Cl)nc(-c3ccccn3)n2COCC[Si](C)(C)C)cc1Cl | |
Identify possible reactants that could have been used to create the specified product. O=CC1CCCCC(=O)N1 | O=C1CCCCC(CO)N1 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CSc1nccc(-c2cnc3c(Cl)nccn23)n1 | COC(OC)C(Br)c1ccnc(SC)n1.Nc1nccnc1Cl | |
O=C1CC2(CCCOC2)Oc2ccc(Br)cc21 Given the product provided, propose some possible reactants that could have been employed in its formation. | CC(=O)c1cc(Br)ccc1O.O=C1CCCOC1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)OCCl | CC(C)(Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)O.ClCCl | |
COc1cccc(O)c1F Given the product provided, propose some possible reactants that could have been employed in its formation. | COc1cccc(B(O)O)c1F.O=S([O-])[O-] | |
Can you identify the reactant(s) that might result in the given product O=c1[nH]c(C(F)(F)F)ccc1[N+](=O)[O-] ? | CCOC=CC(=O)C(F)(F)F.[NH-]C(=O)C[N+](=O)[O-] | |
Can you list the reactants that might result in the chemical product O=C(O)c1nc(Cl)n2c1CN=C(c1ccccc1Cl)c1cc(Cl)ccc1-2 ? | COC(=O)c1nc(Cl)n2c1CN=C(c1ccccc1Cl)c1cc(Cl)ccc1-2 | |
Do retrosynthesis with the product COC(=O)CCCCCN(c1ccc2c(c1)nc(-c1ccccc1)n2-c1ccccc1)S(=O)(=O)c1ccc(C(F)(F)F)cc1 . | COC(=O)CCCCCBr.O=S(=O)(Nc1ccc2c(c1)nc(-c1ccccc1)n2-c1ccccc1)c1ccc(C(F)(F)F)cc1 | |
Given the following product, please provide possible reactants. C=CC(OC(=O)C1C(C=C(Br)Br)C1(C)C)c1cccc(Oc2ccccc2)c1 | C=CC(O)c1cccc(Oc2ccccc2)c1.CC1(C)C(C=C(Br)Br)C1C(=O)Cl | |
Can you list the reactants that might result in the chemical product CC(C)(C)OC(=O)N1CCC2(CCCN2c2cccnc2)C1 ? | Brc1cccnc1.CC(C)(C)OC(=O)N1CCC2(CCCN2)C1 | |
Can you list the reactants that might result in the chemical product Cc1oc(-c2ccccc2)nc1COc1ccc(OCc2ncccc2CC#N)cc1 ? | Cc1oc(-c2ccccc2)nc1COc1ccc(OCc2ncccc2CO)cc1.CCN(CC)CC | |
With the given product NCCCCNC(O)=S, suggest some likely reactants that were used in its synthesis. | NCCCCN.O=C=S | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CCC1(CC(=O)OC)OCC2(CO1)OCCO2 | CCC(=O)CC(=O)OC.OCC1(CO)OCCO1 | |
Nc1cc(Cl)cc(CO)c1Cl Given the product provided, propose some possible reactants that could have been employed in its formation. | Nc1cc(Cl)cc(C(=O)O)c1Cl | |
With the given product Cc1ccc(N)c(S)c1, suggest some likely reactants that were used in its synthesis. | Cc1ccc2nc(N)sc2c1 | |
Do retrosynthesis with the product CS(=O)(=O)c1cccc(Nc2nc(NC3CCCCC3N)cc3c2C(=O)NC3)c1 . | CO.COC(=O)c1c(C#N)cc(NC2CCCCC2N)nc1Nc1cccc(S(C)(=O)=O)c1 | |
CCC(N)c1nc2ccc(F)cc2n1-c1cncc(F)c1 Given the product provided, propose some possible reactants that could have been employed in its formation. | CCC(NC(=O)OC(C)(C)C)c1nc2ccc(F)cc2n1-c1cncc(F)c1 | |
What reactants could lead to the production of the following product? CS(=O)(=O)Cc1ccc(C(=O)O)c(Cl)c1 | CC(C)(C)OC(=O)c1ccc(CS(C)(=O)=O)cc1Cl | |
Could you tell which reactants might have been used to generate the following product? CNN=Cc1c(F)cc(F)cc1F | CNN.O=Cc1c(F)cc(F)cc1F | |
To synthesis Cc1ccc(-c2c(-c3nc(C)n4nc[nH]c(=O)c34)cnn2C)cc1, what are the possible reactants? Write in the SMILES representation. | Cc1ccc(-c2c(-c3cn(NC=N)c(C)n3)cnn2C)cc1.O=C(n1ccnc1)n1ccnc1 | |
Do retrosynthesis with the product CCCC1CCC(C2CC=C(N3CCCC3)CC2)CC1 . | C1CCNC1.CCCC1CCC(C2CCC(=O)CC2)CC1 | |
Given the following product, please provide possible reactants. CC1=C(c2c(C)sc(C)c2C(OC(C)(C)C)C(=O)O)C(C)CCC1 | CCOC(=O)C(OC(C)(C)C)c1c(C)sc(C)c1C1=C(C)CCCC1C | |
With the given product CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(N3CCC(NCC(O)c4ccc(O)c(NS(C)(=O)=O)c4)CC3)cc2)cc1, suggest some likely reactants that were used in its synthesis. | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(N3CCC(=O)CC3)cc2)cc1.CS(=O)(=O)Nc1cc(C(O)CN)ccc1OCc1ccccc1 | |
What reactants could lead to the production of the following product? CC(C)(C)OC(=O)C12CC1CCN2 | CC(C)(C)OC(=O)C12CC1CCN2C(=O)OCc1ccccc1 | |
What reactants could lead to the production of the following product? CC(C)(C)OC(=O)N1C(C(O)C(N)Cc2cccc(O)c2)COC1(C)C | CC(=O)Oc1cccc(CC(C(O)C2COC(C)(C)N2C(=O)OC(C)(C)C)[N+](=O)[O-])c1 | |
Given the following product, please provide possible reactants. CS(=O)(=O)CCN1CCC(c2ccc3c(c2)-n2nc(-c4ncnn4CC(F)(F)F)cc2CCO3)CC1 | C=CS(=O)(=O)C=C.FC(F)(F)Cn1ncnc1-c1cc2n(n1)-c1cc(C3CCNCC3)ccc1OCC2 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. COc1ccc2c(c1)C(N)CCC2 | COc1ccc2c(c1)C(=O)CCC2.NC1CCCc2occc21 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. Cc1cc(-n2c(C)nc3ccccc32)ccc1N | Cc1cc(-n2c(C)nc3ccccc32)ccc1[N+](=O)[O-] | |
To synthesis Nc1ncnc2c1ncn2C1CC(C=Cc2ccccc2)C(CON2C(=O)c3ccccc3C2=O)O1, what are the possible reactants? Write in the SMILES representation. | Nc1ncnc2c1ncn2C1CC(C=Cc2ccccc2)C(CO)O1.O=C1c2ccccc2C(=O)N1O | |
Identify possible reactants that could have been used to create the specified product. N#CCCCCC12CCC(c3cccc(OC4CCCCO4)c3)(CC1)OC2 | CS(=O)(=O)OCCCCC12CCC(c3cccc(OC4CCCCO4)c3)(CC1)OC2.[C-]#N | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. Cc1cc(OCCCN2CCCC2=O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1 | Cc1cc(O)cc(C)c1-c1cccc(COc2ccc(C=O)cc2)c1.O=C1CCCN1CCCO | |
Provide the potential reactants that may be used to produce the product COc1ccc(Cc2ncnn2-c2cc(CCc3ccc(C)cn3)nc(C)n2)cc1OC . | COc1ccc(Cc2ncnn2-c2cc(C#Cc3ccc(C)cn3)nc(C)n2)cc1OC | |
Do retrosynthesis with the product CC(C)=CCC(C)C(O)C=CC1C(O)CC(Cl)C1CC=CCCCC(=O)NS(C)(=O)=O . | CC(C)=CCC(C)C(C=CC1C(OC2CCCCO2)CC(Cl)C1CC=CCCCC(=O)NS(C)(=O)=O)OC1CCCCO1 | |
To synthesis COC(=O)C(Cc1ccccc1)NC(=O)C(C)NC(=O)c1ccccc1, what are the possible reactants? Write in the SMILES representation. | COC(=O)C(N)Cc1ccccc1.CC1C(=O)OC(=O)N1C(=O)c1ccccc1 | |
Identify possible reactants that could have been used to create the specified product. CCC(C(=O)OC)(C(=O)OC)C(Cc1cc(Cl)ccc1[N+](=O)[O-])c1ccc(OC)cc1 | CCI.COC(=O)C(C(=O)OC)C(Cc1cc(Cl)ccc1[N+](=O)[O-])c1ccc(OC)cc1 | |
Nc1nc(C(=O)C(=O)NC2C(=O)N3C(C(=O)O)=C(CSc4nnnn4CC(=O)O)CSC23)cs1 Given the product provided, propose some possible reactants that could have been employed in its formation. | CCC(C)(C)OC(=O)Nc1nc(C(=O)C(=O)NC2C(=O)N3C(C(=O)O)=C(CSc4nnnn4CC(=O)O)CSC23)cs1 | |
Can you identify the reactant(s) that might result in the given product CCOCc1nc2c(N)nc3cc(-c4cccnc4)ccc3c2n1CC1COC(C)(C)O1 ? | c1cncc(B2OCCCO2)c1.CCOCc1nc2c(N)nc3cc(Br)ccc3c2n1CC1COC(C)(C)O1 | |
What reactants could lead to the production of the following product? CC(C)(C)OC(=O)N1CCC(Oc2ccccc2C=O)C(F)C1 | CC(C)(C)OC(=O)N1CCC(O)C(F)C1.O=Cc1ccccc1F | |
Given the following product, please provide possible reactants. Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)Nc1ncc(Cl)cn1 | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)Cl.Nc1ncc(Cl)cn1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. CC(=O)c1nc2cnc3ccsc3c2n1C1CCC(CC#N)OC1 | CC(O)c1nc2cnc3ccsc3c2n1C1CCC(CC#N)OC1 | |
Given the following product, please provide possible reactants. CCN(Cc1cc(C(=O)O)ccc1-c1cncc(CC(=O)O)c1)C(=O)OCc1ccccc1 | CCN(Cc1cc(C(=O)OCc2ccccc2)ccc1-c1cncc(CC(=O)O)c1)C(=O)OCc1ccccc1 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CC(C)N1CCC(CN(CC(NC(=O)OC(C)(C)C)c2ccccc2)C(=O)OCC2c3ccccc3-c3ccccc32)CC1 | CC(C)N1CCC(CNCC(NC(=O)OC(C)(C)C)c2ccccc2)CC1.O=C(OCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O | |
Can you list the reactants that might result in the chemical product O=C(Cc1nc(N2CCOCC2)cc(=O)[nH]1)N1CCc2cc(F)ccc21 ? | Fc1ccc2c(c1)CCN2.O=C([O-])Cc1nc(N2CCOCC2)cc(=O)[nH]1 | |
What reactants could lead to the production of the following product? CC(C)n1c(=O)cc(NC(c2ccccc2)C(F)(F)F)[nH]c1=O | CC(C)n1c(=O)cc(Cl)[nH]c1=O.NC(c1ccccc1)C(F)(F)F | |
Can you identify the reactant(s) that might result in the given product CCOC(=O)CC1(CC)CCN(Cc2ccc(OC)cc2)C1=O ? | CCC1CCN(Cc2ccc(OC)cc2)C1=O.CCOC(=O)CBr | |
Do retrosynthesis with the product Cc1ccc(N)nc1N . | CC(C#N)CCC#N.N | |
COc1ccccc1S(=O)c1cccc(NCc2cccnc2)c1 Given the product provided, propose some possible reactants that could have been employed in its formation. | CO.COC1(S(=O)c2cccc(N)c2)C=CC=CC1.O=Cc1cccnc1 | |
Can you identify the reactant(s) that might result in the given product CCCCCCC(=O)c1ccco1 ? | c1ccoc1.CCCCCCC(=O)O | |
Provide the potential reactants that may be used to produce the product Cc1nc2ccc(CNC(=O)N(C)C)cc2c(=O)n1C1CCC(=O)NC1=O . | Cc1nc2ccc(CN)cc2c(=O)n1C1CCC(=O)NC1=O.CN(C)C(=O)Cl | |
O=[N+]([O-])c1cc(OCc2ccc(Br)cc2)ccc1Cl Given the product provided, propose some possible reactants that could have been employed in its formation. | BrCc1ccc(Br)cc1.O=[N+]([O-])c1cc(O)ccc1Cl | |
What reactants could lead to the production of the following product? CCCC(NC(=O)C1CC(S(=O)(=O)c2ccccc2Cl)CN1C(=O)C1(c2ccc(Br)cc2)CC1)C(=O)C(=O)NC1CC1 | CCCC(N)C(O)C(=O)NC1CC1.O=C(O)C1CC(S(=O)(=O)c2ccccc2Cl)CN1C(=O)C1(c2ccc(Br)cc2)CC1 | |
Do retrosynthesis with the product O=C1C(Cc2c(Cl)cc(O)cc2Cl)CCN1N1CCCCC1 . | COc1cc(Cl)c(CC2CCN(N3CCCCC3)C2=O)c(Cl)c1 | |
Given the following product, please provide possible reactants. c1cncc(-c2ccc(Cn3ccnc3)cn2)c1 | Brc1ccc(Cn2ccnc2)cn1.OB(O)c1cccnc1 | |
What reactants could lead to the production of the following product? CCOC(=O)C(CCC1CCN(C(=O)OC(C)(C)C)CC1)NCc1ccccc1 | CC(C)(C)OC(=O)N1CCC(CCI)CC1.CC(C)(C)[O-].N=Cc1ccccc1.NCC(=O)O | |
Do retrosynthesis with the product CCCCOc1cccc(C(F)C#N)c1 . | CCCCOc1cccc(CC#N)c1.O=S(=O)(c1ccccc1)N(F)S(=O)(=O)c1ccccc1 | |
Provide the potential reactants that may be used to produce the product CCCCN(C)C(=O)CCCCCCCBr . | CCCCNC.O=C(O)CCCCCCCBr | |
With the given product Cn1ncc2[nH]c(-c3ccncc3)nc2c1=O, suggest some likely reactants that were used in its synthesis. | Cn1ncc(N)c(N)c1=O.O=Cc1ccncc1 | |
Identify possible reactants that could have been used to create the specified product. COc1cccc(-c2ccccn2)c1 | Brc1ccccn1.COc1cccc(B(O)O)c1 | |
What reactants could lead to the production of the following product? CN(Cc1ccccc1)C1CN(C(=O)OC(C)(C)C)C1 | CC(C)(C)OC(=O)N1CC(=O)C1.CNCc1ccccc1 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CCCn1cc(-n2ccc3ccc(Cl)cc32)cn1 | CCCn1cc(Br)cn1.O=C1Cc2ccc(Cl)cc2N1 | |
To synthesis O=C(O)c1cc(-c2nc(-c3cccs3)cs2)ccc1-c1ccccc1[N+](=O)[O-], what are the possible reactants? Write in the SMILES representation. | COC(=O)c1cc(C(N)=S)ccc1-c1ccccc1[N+](=O)[O-].O=C(CBr)c1cccs1 | |
Can you identify the reactant(s) that might result in the given product CCCc1c(Cc2ccc(-c3ccccc3C#N)cc2F)c(=O)n(C2CCC(OC(C)C(N)=O)CC2)c2nc(C)nn12 ? | CCCc1c(Cc2ccc(-c3ccccc3C#N)cc2F)c(=O)n(C2CCC(O)CC2)c2nc(C)nn12.CCOC(=O)C(C)C[N+]#N.[OH-] | |
Given the following product, please provide possible reactants. COc1ccc(-c2c(C)nn3c(-c4ccc(F)c(F)c4)cc(N4CCCC4CO)nc23)cc1 | Cc1nn2c(-c3ccc(F)c(F)c3)cc(N3CCCC3CO)nc2c1I.COc1ccc(B(O)O)cc1 | |
To synthesis COc1cc(C(C)NC(C)c2cccc(Cl)c2)nn1-c1ccc(C#N)cc1, what are the possible reactants? Write in the SMILES representation. | CN(C)C=O.COc1cc(C(C)NC(C)c2cccc(Cl)c2)nn1-c1ccc(Br)cc1 | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. COc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1cc(Br)c(C)c(-c3cccnc3)c1)CC2 | COc1cc2c(cc1C(F)(F)F)N(C(=O)Nc1cc(Br)c(C)c(Br)c1)CC2.OB(O)c1cccnc1 | |
Given the following product, please provide possible reactants. O=C(NC1(C(=O)NC2CSc3cc(Br)ccc32)CC1)C(F)(F)F | NC1CSc2cc(Br)ccc21.O=C(NC1(C(=O)O)CC1)C(F)(F)F | |
To synthesis CCCCn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]c(Cc3ccc(NS(=O)(=O)c4c(C)cc(Cl)cc4Cl)cc3)nc21, what are the possible reactants? Write in the SMILES representation. | Cc1cc(Cl)cc(Cl)c1S(=O)(=O)Cl.CCCCn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]c(Cc3ccc(N)cc3)nc21 | |
Identify possible reactants that could have been used to create the specified product. COc1cc(Br)c2c(c1)CCCC2 | O=C([O-])[O-].Oc1cc(Br)c2c(c1)CCCC2 | |
Given the following product, please provide possible reactants. Cc1ccc(-c2noc(CO)n2)cc1NC(=O)c1cnc2ccc(Br)cn12 | CC(=O)OCC(=O)O.Cc1ccc(C(=N)NO)cc1NC(=O)c1cnc2ccc(Br)cn12 | |
Do retrosynthesis with the product CCC1C(=O)N(C)c2ccc(F)cc2N1C(=O)c1ccc(OC)cc1 . | CCC1C(=O)N(C)c2cc(F)ccc2N1C(=O)c1ccc(OC)cc1.CCC1C(=O)Nc2ccc(F)cc2N1C(=O)c1ccc(OC)cc1 | |
To synthesis Oc1ccccc1, what are the possible reactants? Write in the SMILES representation. | Oc1ccccc1O | |
Can you identify the reactant(s) that might result in the given product O=[N+]([O-])C=CC(F)(F)F ? | C[N+](=O)[O-].OC(O)C(F)(F)F | |
Can you list the reactants that might result in the chemical product CCC(CC)(NC(=O)c1ccc(C2CC2)c(OCC2CC2)n1)C(=O)NCCOC ? | CCC(CC)(NC(=O)c1ccc(C2CC2)c(OCC2CC2)n1)C(=O)O.COCCN | |
Provide the potential reactants that may be used to produce the product NC(=O)Cc1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 . | CCN(CC)CC.O=C(O)Cc1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. COc1ccc(-c2ccc(C(=O)O)cc2)cc1OCCCCc1ccccc1 | COC(=O)c1ccc(I)cc1.COc1ccc(Br)cc1OCCCCc1ccccc1 | |
Do retrosynthesis with the product COC(=O)c1cc(N)cc(-c2ccccc2Br)c1 . | Brc1ccccc1Br.COC(=O)c1cc(N)cc(B(O)O)c1 | |
Could you tell which reactants might have been used to generate the following product? CCOP(=O)(Cc1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccc(-c4cnn(CC(F)(F)CO)c4)nc3C(=O)NC)n2)c(OC)c1)OCC | CCOP(=O)(Cc1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccc(-c4cnn(CCCO)c4)c4c3C(=O)N(C)C4)n2)c(OC)c1)OCC.CNC(=O)c1nc(-c2cnn(CC(F)(F)CO)c2)ccc1N | |
To synthesis CCOC(=O)C(O)C(O)c1ccc(OC)cc1, what are the possible reactants? Write in the SMILES representation. | C=CC(=O)OCC.CCCCO.CCC1CN2CCC1CC2C(Oc1nnc(OC(c2ccnc3ccc(OC)cc23)C2CC3CCN2CC3CC)c2ccccc12)c1ccnc2ccc(OC)cc12.COc1ccc(I)cc1 | |
Given the following product, please provide possible reactants. Oc1ccc2nc(-c3ccc(-c4nn[nH]n4)cc3)cc(Cl)c2c1 | C[Si](C)(C)N=[N+]=[N-].N#Cc1ccc(-c2cc(Cl)c3cc(O)ccc3n2)cc1 | |
Can you identify the reactant(s) that might result in the given product COc1ccc2nccc(NC(=O)C3CCN(CC(=O)c4ccc5c(c4)NC(=O)CS5)CC3)c2n1 ? | COc1ccc2nccc(NC(=O)C3CCNCC3)c2n1.O=C1CSc2ccc(C(=O)CCl)cc2N1 | |
With the given product COc1ccc(-n2nc(C#N)c3c2C(=O)N(c2ccc(C(C)(C)CN4CCCC4=O)cc2)CC3)cc1, suggest some likely reactants that were used in its synthesis. | CC(C)(CN1CCCC1=O)c1ccc(I)cc1.COc1ccc(-n2nc(C#N)c3c2C(=O)NCC3)cc1 | |
Could you tell which reactants might have been used to generate the following product? COC(=O)c1csc(-c2ccccc2)c1 | COC(=O)c1cc(-c2ccccc2)sc1N | |
To synthesis O=C(O)C(O)(c1ccccc1)C1CCCCC1, what are the possible reactants? Write in the SMILES representation. | O=C(O)C(O)(C1=CCCCC1)c1ccccc1 | |
With the given product O=C(O)C(O)(c1ccccc1)C1CCCCC1, suggest some likely reactants that were used in its synthesis. | O=C(O)C(O)(C1=CCCCC1)c1ccccc1 | |
To synthesis O=C(O)Cc1ccc(NC(=O)C(Cc2ccccc2)NS(=O)(=O)c2ccc(Br)cc2)cc1, what are the possible reactants? Write in the SMILES representation. | CCOC(=O)Cc1ccc(NC(=O)C(Cc2ccccc2)NS(=O)(=O)c2ccc(Br)cc2)cc1 | |
Do retrosynthesis with the product COc1c(C)cnc(CN2N=C3CC(N)C4=C3C(=N2)C(N)=NSC4)c1C . | COc1c(C)cnc(CN2N=C3CC(=O)C4=C3C(=N2)C(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=NSC4)c1C.[BH3-]C#N | |
With the given product CCOC(=O)C1=C(N)SC(C)C1(O)C(F)(F)F, suggest some likely reactants that were used in its synthesis. | CC(=O)SC(C)C(=O)C(F)(F)F.CCOC(=O)CC#N | |
Can you list the reactants that might result in the chemical product CCC(CC)c1ccc(Cl)c2nc3n(c12)CC(=O)N3c1c(C)cc(Cl)cc1OC ? | CCC(CC)c1ccc(Cl)c2nc(Nc3c(C)cc(Cl)cc3OC)n(CC(=O)O)c12 | |
Can you identify the reactant(s) that might result in the given product Clc1cc(N2CCCCC2)ncn1 ? | C1CCNCC1.Clc1cc(Cl)ncn1 | |
With the given product NC(=O)C#CC(=O)c1ccc(Br)cc1, suggest some likely reactants that were used in its synthesis. | C#CCN.O=C(Cl)c1ccc(Br)cc1.O=C([O-])[O-] | |
With the given product CC(C)CCCC(C)CCOc1ccc(C(=O)Cl)cc1, suggest some likely reactants that were used in its synthesis. | CC(C)CCCC(C)CCOc1ccc(C(=O)O)cc1.O=S(Cl)Cl | |
Can you identify the reactant(s) that might result in the given product O=C([O-])C(=O)[O-] ? | O=C(O)C(=O)O | |
Based on the given product, provide some plausible reactants that might have been utilized to prepare it. C=C1CC(N)CCN(c2c(NC(=O)c3nc(-c4c(F)cccc4F)sc3N)cnn2C)C1 | Cn1ncc(NC(=O)c2nc(-c3c(F)cccc3F)sc2N)c1N1CCC(N)CC2(CCO2)C1 | |
Suggest possible substances that may have been involved in the synthesis of the presented compound. CCOc1nc(NCc2ccc(S(N)(=O)=O)cc2)nc2ccc(-c3ccc(F)cc3)nc12 | CC[O-].NS(=O)(=O)c1ccc(CNc2nc(-n3cnnc3)c3nc(-c4ccc(F)cc4)ccc3n2)cc1 |